You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1983306 |
---|---|
Category | Small Molecules |
Description | Valienamine, an alpha-glucosidase inhibitor, is the crucial functional component of several natural glycosidase inhibitors, such as the crop protectant validamycin A and the antidiabetic agent acarbose [1]. |
Purity | 98.00% |
MW | 175.18 |
Biological Activity | Valienamine, an alpha-glucosidase inhibitor, is the crucial functional component of several natural glycosidase inhibitors, such as the crop protectant validamycin A and the antidiabetic agent acarbose [1]. |
CAS Number | 38231-86-6 |
Formula | C7H13NO4 |
SMILES | N[C@H]1C=C(CO)[C@@H](O)[C@H](O)[C@H]1O |
Storage | -20°C |
Note | For research use only |