You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1309816 |
---|---|
Category | Small Molecules |
Description | Valacyclovir hydrochloride |
Purity | 100.00% |
MW | 360.8 |
Biological Activity | Valacyclovir hydrochloride (Valaciclovir hydrochloride) is an acyclovir prodrug that inhibits viral DNA replication after metabolization. |
CAS Number | [124832-27-5] |
Formula | C13H20N6O4·HCl |
SMILES | Cl.CC(C)[C@H](N)C(=O)OCCOCn1cnc2c1nc(N)[nH]c2=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
124832-27-5 | |
360.8 | |
C13H21ClN6O4 |
98.00% | |
1218948-84-5 | |
378.81 | |
C13H23ClN6O5 |