You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2278531 |
---|---|
Category | Small Molecules |
Description | Uridine 5'-diphosphate acts as a P2Y6 receptor agonist, exhibiting an EC50 value of 0.013 μM for the human P2Y6 receptor [1]. |
Purity | 98.00% |
MW | 404.16 |
Biological Activity | Uridine 5'-diphosphate acts as a P2Y6 receptor agonist, exhibiting an EC50 value of 0.013 μM for the human P2Y6 receptor [1]. |
CAS Number | 58-98-0 |
Formula | C9H14N2O12P2 |
SMILES | O[C@H]1[C@@H](O[C@H](COP(OP(=O)(O)O)(=O)O)[C@H]1O)N2C(=O)NC(=O)C=C2 |
Storage | -20°C |
Note | For research use only |
98.00% | |
21931-53-3 | |
470.106 | |
C9H11N2Na3O12P2 |
98.86% | |
27821-45-0 | |
448.12 | |
C9H12N2Na2O12P2 |