You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb611871 |
---|---|
Category | Small Molecules |
Description | Triptorelin is a synthetic decapeptide agonist analog of luteinizing hormone releasing hormone (LHRH), shows greater potency than endogenous LHRH, triptorelin reversibly represses gonadotropin secretion.. |
MW | 1311.449 |
CAS Number | [57773-63-4] |
Formula | C64H82N18O13 |
SMILES | NC(NCCC[C@@H](C(N1CCC[C@H]1C(NCC(=O)N)=O)=O)NC([C@@H](NC([C@@H](CC1=CNC2=CC=CC=C12)NC([C@@H](NC([C@@H](NC([C@H](CC1=CNC2=CC=CC=C12)NC([C@@H](NC([C@@H]1CCC(=O)N1)=O)CC1=CN=CN1)=O)=O)CO)=O)CC1=CC=C(O)C=C1)=O)=O)CC(C)C)=O)=N |
Note | For research use only |
> 98% (HPLC) | |
140194-24-7 | |
1371.5 | |
C66H86N18O15 |
99.90% | |
[140194-24-7] | |
1371.53 | |
C66H86N18O15 |