You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1739356 |
---|---|
Category | Small Molecules |
Description | Tomivosertib HCl |
Purity | 98.00% |
MW | 376.845 |
Biological Activity | Tomivosertib, also known as eFT508 is a MNK1/2 inhibitor. Tomivosertib binds to and inhibits the activity of MNK1 and 2. This prevents MNK1/2-mediated signaling, and inhibits the phosphorylation of certain regulatory proteins, including eukaryotic translation initiation factor 4E (eIF4E), that regulate the translation of messenger RNAs (mRNAs) involved in tumor cell proliferation, angiogenesis, survival and immune signaling. |
CAS Number | 1849590-02-8 |
Formula | C17H21ClN6O2 |
SMILES | Cl.Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CCCCC1 |
Storage | -20°C |
Note | For research use only |