You have no items in your shopping cart.
Cart summary
Tetrahydroxyquinone monohydrate
Catalog Number: orb1745114
| Catalog Number | orb1745114 |
|---|---|
| Category | Small Molecules |
| Description | Tetrahydroxyquinone monohydrate (Tetrahydroxy-1,4-benzoquinone monohydrate) is a redox-active benzoquinone and early-stage anticataract agent that engages in redox cycling with semiquinone radicals, leading to the generation of reactive oxygen species (ROS). |
| CAS Number | 1215458-51-7 |
| Purity | 98.00% |
| MW | 190.11 |
| SMILES | O=C1C(O)=C(O)C(=O)C(O)=C1O.O |
| Formula | C6H6O7 |
| Biological Activity | Tetrahydroxyquinone monohydrate (Tetrahydroxy-1,4-benzoquinone monohydrate), serving as an early-stage anticataract agent, is a redox-active benzoquinone. This compound engages in redox cycling with semiquinone radicals, resulting in the generation of reactive oxygen species (ROS). |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
