You have no items in your shopping cart.
Cart summary
Terbuthylazine-desethyl-d9 (tert-butyl-d9)
Catalog Number: orb2299549
| Catalog Number | orb2299549 |
|---|---|
| Category | Small Molecules |
| Description | Terbuthylazine-desethyl-d9 (tert-butyl-d9) is a deuterated compound of Terbuthylazine-desethyl. Terbuthylazine-desethyl has a CAS number of 30125-63-4. |
| CAS Number | 1219798-52-3 |
| Purity | 98.00% |
| MW | 210.71 |
| SMILES | C(NC1N=C(Cl)N=C(N)N=1)(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| Formula | C7H3D9ClN5 |
| Biological Activity | Terbuthylazine-desethyl-d9 (tert-butyl-d9) is a deuterated compound of Terbuthylazine-desethyl. Terbuthylazine-desethyl has a CAS number of 30125-63-4. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
