You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1296653 |
---|---|
Category | Small Molecules |
Description | TB500 |
Purity | 99.51% |
MW | 889.01 |
Biological Activity | TB-500 is a synthesised peptide, essentially a short-chain version of the naturally occurring Thymosin Beta-4. |
CAS Number | [885340-08-9] |
Formula | C38H68N10O14 |
SMILES | CC(C)C[C@H](NC(C)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCC(N)=O)C(O)=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
885340-08-9 | |
889 | |
C38H68N10O14 |
100.00% | |
949.06 | |
C40H72N10O16 |