You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2695018 |
---|---|
Category | Small Molecules |
Description | Taspoglutide, acting as an agonist for the glucagon-like peptide-1 receptor (GLP-1R; Ki = 1.1 nM for the human receptor), induces cAMP accumulation in CHO-K1 cells expressing human GLP-1R (EC50 = 0.06 nM). In oral glucose tolerance tests conducted on Zucker diabetic fatty rats, Taspoglutide (administered weekly at 1 mg/animal) significantly reduced blood glucose levels and increased insulin levels. Additionally, in the same model, it also lowered blood levels of gastric inhibitory polypeptide (GIP), plasma triglycerides, and body weight. |
MW | 3339.76(Free base) |
CAS Number | 1022150-16-8 |
Formula | C152H232N40O45 xC2H4O2 |
SMILES | C(C)(O)=O.C([C@@H](C(N[C@H](C(N[C@H](C(N[C@H](C(NC(C(N[C@@H](CCCNC(=N)N)C(N)=O)=O)(C)C)=O)CCCCN)=O)[C@H](C)C)=O)CC(C)C)=O)NC([C@@H](NC([C@@H](NC([C@H](CC1=CC=CC=C1)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC(CNC([C@@H](NC([C@@H](NC([C@H](CC2=CC=C(O)C=C2)NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@@H](NC([C@H](CC3=CC=CC=C3)NC([C@@H](NC(CNC([C@@H](NC(C(NC([C@H](CC4=CN=CN4)N)=O)(C)C)=O)CCC(O)=O)=O)=O)[C@@H](C)O)=O)=O)[C@@H](C)O)=O)CO)=O)CC(O)=O)=O)C(C)C)=O)CO)=O)CO)=O)=O)CC(C)C)=O)CCC(O)=O)=O)=O)CCC(N)=O)=O)C)=O)C)=O)CCCCN)=O)CCC(O)=O)=O)=O)[C@H](CC)C)=O)C)=O)C=5C=6C(NC5)=CC=CC6 |
Storage | -20°C |
Note | For research use only |