You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1685496 |
---|---|
Category | Small Molecules |
Description | Substance P(1-7) |
Purity | 98.00% |
MW | 900.04 |
Biological Activity | Substance P(1-7) (Substance P 1-7) is the major bioactive metabolite formed after proteolytic degradation of the tachykinin substance P (SP),with anti-inflammatory, anti-nociceptive and anti-hyperalgesic effects |
CAS Number | [68060-49-1] |
Formula | C41H65N13O10 |
SMILES | N=C(N)NCCCC(N)C(=O)N1CCCC1C(=O)NC(CCCCN)C(=O)N1CCCC1C(=O)NC(CCC(N)=O)C(=O)NC(CCC(N)=O)C(=O)NC(Cc1ccccc1)C(=O)O |
Storage | -20°C |
Note | For research use only |
98.23% | |
2828433-22-1 | |
1014.06 | |
C43H66F3N13O12 |
≥98% | |
1128.08 | |
C45H67F6N13O14 |