You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299031 |
---|---|
Category | Small Molecules |
Description | STING agonist-1 |
Purity | 99.07% |
MW | 430.88 |
Biological Activity | STING agonist-1 (G10) is a human-specific STING agonist,elicits antiviral activity against emerging Alphaviruses. |
CAS Number | [702662-50-8] |
Formula | C21H16ClFN2O3S |
SMILES | Fc1cccc(Cl)c1CN1C(=O)CSc2ccc(cc12)C(=O)NCc1ccco1 |
Storage | -20°C |
Note | For research use only |
99.72% | |
2138498-18-5 | |
849.94 | |
C42H51N13O7 |
99.55% | |
[2138299-34-8] | |
959.32 | |
C42H54Cl3N13O7 |
98.29% | |
[2138299-33-7] | |
849.94 | |
C42H51N13O7 |