You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1706605 |
---|---|
Category | Small Molecules |
Description | SR2211 |
Purity | 98.20% |
MW | 527.48 |
Biological Activity | SR2211 is a specific modulator and an inverse agonist of RORγ(IC50 = 320 nM, Ki = 105 nM). |
CAS Number | [1359164-11-6] |
Formula | C26H24F7N3O |
SMILES | OC(c1ccc(c(F)c1)-c1ccc(CN2CCN(Cc3ccncc3)CC2)cc1)(C(F)(F)F)C(F)(F)F |
Storage | -20°C |
Note | For research use only |