You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2893321 |
---|---|
Category | Small Molecules |
Description | siaresinolic acid is a natural product that can be used in related research in the field of life sciences. Its product number is orb2893321. |
MW | 472.70 |
CAS Number | 511-77-3 |
Formula | C30H48O4 |
SMILES | C(O)(=O)[C@]12[C@](C=3[C@@](C)(CC1)[C@@]4(C)[C@](CC3)([C@]5(C)[C@@](CC4)(C(C)(C)[C@@H](O)CC5)[H])[H])([C@H](O)C(C)(C)CC2)[H] |
Storage | -20°C |
Note | For research use only |
98.00% | |
[155653-86-4] | |
634.84 | |
C36H58O9 |
356785-71-2 | |
766.96 | |
C41H66O13 |