You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1297211 |
---|---|
Category | Small Molecules |
Description | Secoisolariciresinol |
CAS Number | 29388-59-8 |
Purity | 99.65% |
MW | 362.42 |
SMILES | COc1cc(C[C@@H](CO)[C@H](CO)Cc2ccc(O)c(OC)c2)ccc1O |
Formula | C20H26O6 |
Biological Activity | Secoisolariciresinol is an enterolignan precursor, it has antioxidant, and estrogen-like activities, it can significantly suppress triglyceride (TG) accumulation in 3T3-L1 adipocytes. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98% | |
257930-74-8 | |
686.7 | |
C32H46O16 |
100.00% | |
148244-82-0 | |
686.704 | |
C32H46O16 |