You have no items in your shopping cart.
Cart summary
Schisandrin B
Catalog Number: orb1304837
| Catalog Number | orb1304837 |
|---|---|
| Category | Small Molecules |
| Description | Schisandrin B |
| CAS Number | 61281-37-6 |
| Purity | 100.00% |
| MW | 400.46 |
| SMILES | COc1cc2C[C@H](C)[C@H](C)Cc3cc4OCOc4c(OC)c3-c2c(OC)c1OC |
| Formula | C23H28O6 |
| Biological Activity | Schisandrin B (Schisandrin B (Sch B)) has an antioxidant effect on rodent liver and heart. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
- Item 1 of 1
