You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1744750 |
---|---|
Category | Small Molecules |
Description | SARS-CoV-2-IN-12 |
CAS Number | 2721455-52-1 |
Purity | 98.00% |
MW | 697.7 |
SMILES | C(C(O)=O)(F)(F)F.O(C)C1=C2C(NC(C(N[C@H](C(N[C@@H](C[C@H]3C(=O)NCC3)C(COC(=O)[C@@H]4N(C)CCC4)=O)=O)CC(C)C)=O)=C2)=CC=C1 |
Formula | C32H42F3N5O9 |
Biological Activity | SARS-CoV-2-IN-12, a potent inhibitor of the SARS-CoV-2-related 3C-like protease (K_i=32.1 pM), plays a crucial role in preventing SARS-CoV-2 viral replication, showcasing potential significance in COVID-19 research. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Filter by Rating