You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb315525 |
---|---|
Category | Small Molecules |
Description | (S)-Equol preferentially binds ERβ (Ki = 0.73 nM) and demonstrates approximately 9-fold lower affinity for ERα (Ki = 6.41 nM). |
CAS Number | [531-95-3] |
MW | 242.2699 |
SMILES | O1C2C([H])=C(C([H])=C([H])C=2C([H])([H])[C@@]([H])(C2C([H])=C([H])C(=C([H])C=2[H])O[H])C1([H])[H])O[H] |
Formula | C15H14O3 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.61% | |
531-95-3 | |
242.27 | |
C15H14O3 |