You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1305978 |
---|---|
Category | Small Molecules |
Description | RU 58841 |
Purity | 99.77% |
MW | 369.34 |
Biological Activity | RU 58841 (PSK-3841) is a specific androgen receptor antagonist or anti-androgen; RU 58841(PSK-3841) has a significant effect on hair regrowth. |
CAS Number | [154992-24-2] |
Formula | C17H18F3N3O3 |
SMILES | CC1(C)N(CCCCO)C(=O)N(C1=O)c1ccc(C#N)c(c1)C(F)(F)F |
Storage | -20°C |
Note | For research use only |