You have no items in your shopping cart.
Cart summary
(Rac)-Hesperetin
Catalog Number: orb1909564
| Catalog Number | orb1909564 |
|---|---|
| Category | Small Molecules |
| Description | (Rac)-Hesperetin, the racemate form of Hesperetin, is a natural flavanone compound exhibiting potent inhibitory effects against human UGT activity, making it a broad-spectrum inhibitor. Additionally, Hesperetin induces apoptosis through the activation of p38 MAPK. |
| CAS Number | 69097-99-0 |
| Purity | 98.00% |
| MW | 302.28 |
| SMILES | O=C1C=2C(OC(C1)C3=CC(O)=C(OC)C=C3)=CC(O)=CC2O |
| Formula | C16H14O6 |
| Biological Activity | (Rac)-Hesperetin is the racemate form of of Hesperetin. Hesperetin is a natural flavanone compound, and it exhibits potent inhibitory effects against human UGT activity, making it a broad-spectrum inhibitor. Furthermore, Hesperetin induces apoptosis through the activation of p38 MAPK. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
