You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304818 |
---|---|
Category | Small Molecules |
Description | Psoralen |
CAS Number | 66-97-7 |
Purity | 100% |
MW | 186.16 |
SMILES | O=C1OC2=C(C=C3C(=C2)OC=C3)C=C1 |
Formula | C11H6O3 |
Biological Activity | Psoralen (Ficusin) is a furocoumarin that intercalates with DNA, inhibiting DNA synthesis and cell division. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.00% | |
55481-87-3 | |
332.352 | |
C18H20O6 |
98.00% | |
144398-34-5 | |
354.4 | |
C21H22O5 |