You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1688619 |
---|---|
Category | Small Molecules |
Description | PPARγ agonist 7 |
Purity | 98.00% |
MW | 366.45 |
Biological Activity | PPARγ agonist 7 (Compound 3a) is a highly potent and selective agonist of the peroxisome proliferator-activated receptor gamma (PPARγ). It specifically stimulates adiponectin production in human bone marrow mesenchymal stem cells (hBM-MSCs), making it an innovative full agonist of PPARγ with an EC 50 value of 4.34 μM [1]. |
CAS Number | 2569295-93-6 |
Formula | C20H30O6 |
SMILES | C(\CCCCCCCC/C=C\1/C(=O)O[C@@H](C)[C@H]1O)=C\2/C(=O)O[C@@H](C)[C@H]2O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
16692-52-7 | |
342.3 | |
C19H18O6 |
98.00% | |
845673-74-7 | |
342.479 | |
C22H30O3 |