You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1943346 |
---|---|
Category | Small Molecules |
Description | Poricoic acid H, a triterpene [1], is a significant chemical compound known for its bioactive properties in various medicinal applications. |
CAS Number | 415724-85-5 |
Purity | 98.00% |
MW | 500.71 |
SMILES | C[C@]12[C@@](C)([C@@]([C@@H](CCC(C(C)C)=C)C(O)=O)([C@H](O)C1)[H])CCC3=C2CC[C@@H](C(C)=C)[C@@]3(CCC(O)=O)C |
Formula | C31H48O5 |
Biological Activity | Poricoic acid H is a triterpene [1]. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |