You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1681313 |
---|---|
Category | Small Molecules |
Description | (±)-Pinoresinol |
CAS Number | 4263-88-1 |
Purity | 98% |
MW | 358.39 |
SMILES | COc1cc(ccc1O)[C@@H]1OC[C@@H]2[C@H]1CO[C@H]2c1ccc(O)c(OC)c1 |
Formula | C20H22O6 |
Biological Activity | (±)-Pinoresinol is a natural product for research related to life sciences. The catalog number is orb1681313 and the CAS number is 4263-88-1. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
96.04% | |
63902-38-5 | |
682.67 | |
C32H42O16 |
98.67% | |
487-36-5 | |
358.39 | |
C20H22O6 |
99.78% | |
81446-29-9 | |
358.39 | |
C20H22O6 |
99.75% | |
29106-36-3 | |
386.44 | |
C22H26O6 |
98% | |
41607-20-9 | |
520.531 | |
C26H32O11 |