You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1304651 |
---|---|
Category | Small Molecules |
Description | Phlorizin dihydrate |
CAS Number | 7061-54-3 |
Purity | 98.41% |
MW | 454.42 |
SMILES | O.O.OC[C@H]1O[C@@H](Oc2cc(O)cc(O)c2C(=O)CCc2ccc(O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
Formula | C21H26O11 |
Biological Activity | 1. Phlorizin dihydrate (Phloridzin dihydrate) can significantly inhibit oxidative DNA damage. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |