You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1706830 |
---|---|
Category | Small Molecules |
Description | Penicillin G Procaine |
CAS Number | 6130-64-9 |
Purity | 98% |
MW | 588.72 |
SMILES | O.CCN(CC)CCOC(=O)c1ccc(N)cc1.[H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)Cc1ccccc1)C(O)=O |
Formula | C29H40N4O7S |
Biological Activity | Penicillin G Procaine is a β-lactam antibiotic and is a crystalline complex produced by chemically combining penicillin G with procaine. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
99.53% | |
54-35-3 | |
570.7 | |
C29H38N4O6S |