You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1981772 |
---|---|
Category | Small Molecules |
Description | Pedunculagin, a potent 5α-reductase type 1 inhibitor, effectively inhibits the production of nitric oxide (NO), IL-6, and IL-8 while also decreasing the protein expression of 5α-reductase. Additionally, it exhibits anti-inflammatory activity [1]. |
Purity | 98.00% |
MW | 936.65 |
Biological Activity | Pedunculagin, a potent 5α-reductase type 1 inhibitor, effectively inhibits the production of nitric oxide (NO), IL-6, and IL-8 while also decreasing the protein expression of 5α-reductase. Additionally, it exhibits anti-inflammatory activity [1]. |
CAS Number | 113866-64-1 |
Formula | C41H28O26 |
SMILES | OC1C2C(C3C(O1)COC(=O)C=4C(C=5C(C(=O)O3)=CC(O)=C(O)C5O)=C(O)C(O)=C(O)C4)OC(=O)C=6C(C=7C(C(=O)O2)=CC(O)=C(O)C7O)=C(O)C(O)=C(O)C6 |
Storage | -20°C |
Note | For research use only |