You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1981222 |
---|---|
Category | Small Molecules |
Description | Peceleganan (PL-5), a synthetic hybrid peptide, combines cecropin A (1-10) and melittin B (3-18) sequences to form a (10+16)-peptide analogue with antimicrobial properties. This compound effectively inhibits wound infections [1]. |
Purity | 98.00% |
MW | 2933.5 |
Biological Activity | Peceleganan (PL-5), a synthetic hybrid peptide, combines cecropin A (1-10) and melittin B (3-18) sequences to form a (10+16)-peptide analogue with antimicrobial properties. This compound effectively inhibits wound infections [1]. |
CAS Number | 850761-47-6 |
Formula | C138H226N36O34 |
SMILES | C([C@@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC1=CC=CC=C1)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC2=CC=CC=C2)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC3=CN=CN3)C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N)=O)CO)=O)CO)=O)[C@H](CC)C)=O)C)=O)CCCCN)=O)CC(C)C)=O)C)=O)[C@@H](C)O)=O)=O)CC(C)C)=O)C(C)C)=O)[C@@H](C)O)=O)CCCCN)=O)C)=O)C)=O)CO)=O)CCCCN)=O)=O)[C@@H](C)O)=O)CCCCN)=O)CC(C)C)=O)=O)CO)=O)CCCCN)=O)NC([C@H](CCCCN)NC(C)=O)=O)C=4C=5C(NC4)=CC=CC5 |
Storage | -20°C |
Note | For research use only |