You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1685461 |
---|---|
Category | Small Molecules |
Description | PAR-4 Agonist Peptide, amide |
Purity | 98.00% |
MW | 680.79 |
Biological Activity | PAR-4 Agonist Peptide, amide (AY-NH2) is an agonist of proteinase-activated receptor-4 (PAR-4). |
CAS Number | [352017-71-1] |
Formula | C34H48N8O7 |
SMILES | C([C@H](CC1=CC=C(O)C=C1)NC([C@H](C)N)=O)(=O)N2[C@H](C(NCC(N[C@H](C(N[C@@H](CC3=CC=CC=C3)C(N)=O)=O)CCCCN)=O)=O)CCC2 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
—— | |
908.8 | |
C38H50F6N8O11 |
≥95% | |
680.79 |
98.00% | |
740.86 | |
C36H52N8O9 |
100.00% | |
[1228078-65-6] | |
794.82 | |
C36H49F3N8O9 |