You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb181301 |
---|---|
Category | Small Molecules |
Description | PAC-1 is a potent procaspase-3 activator with EC50 of 0.22 μM and the first small molecule known to directly activate procaspase-3 to caspase-3. |
CAS Number | [315183-21-2] |
MW | 392.49 |
SMILES | C(N/N=C/C1=CC=CC(CC=C)=C1O)(=O)CN1CCN(CC2=CC=CC=C2)CC1 |
Formula | C23H28N4O2 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
FC, ICC, IP | |
Human | |
Monoclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P, WB | |
Mouse | |
Human, Mouse | |
Rabbit | |
Polyclonal | |
Unconjugated |