You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1300223 |
---|---|
Category | Small Molecules |
Description | Oroxylin A |
Purity | 99.67% |
MW | 284.26 |
Biological Activity | 1. Oroxylin A (Baicalein 6-methyl ether) has various anti-tumor effects including apoptosis, cell cycle arrest, drug-resistant reversion. 2. Oroxylin A possesses abilities of inhibiting the ATRA-induced IL-6 production via modulation of LAP/LIP/CHOP in leukemia cell lines, which could providing a therapeutic strategy for RAS. 3. Oroxylin A inhibits UCP2s triggers the MPTP opening, and promotes the apoptosis in CaCo-2 cells; uncoupling protein 2 plays a key role in mitochondrial apoptotic pathway. 4. Oroxylin A inhibits N1ICD translocating to the nucleus and binding to epithelial-mesenchymal transition-related transcription factor Snail, thus suppressing the invasion and migration of MCF-7 cells. 5. Oroxylin A improves the sensitivity of K562/ADM cells by increasing apoptosis in leukemic cells and decreasing the expression of CXCR4 and PI3K/Akt/NF-κB pathway, and probably served as a most promising agent for CML treatment. |
CAS Number | [480-11-5] |
Formula | C16H12O5 |
SMILES | COc1c(O)cc2oc(cc(=O)c2c1O)-c1ccccc1 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
36948-76-2 | |
460.4 | |
C22H20O11 |
> 98% (HPLC) | |
36948-77-3 | |
446.4 | |
C22H22O10 |
98.00% | |
82475-02-3 | |
474.41 | |
C23H22O11 |
99.02% | |
[36948-77-3] | |
446.4 | |
C22H22O10 |