You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2276859 |
---|---|
Category | Small Molecules |
Description | Olodaterol is a novel, long-acting beta2-adrenergic agonist (LABA) that exerts its pharmacological effect by binding and activating beta2-adrenergic receptors located primarily in the lungs. |
Purity | 98.90% |
MW | 386.45 |
Biological Activity | Olodaterol is a novel, long-acting beta2-adrenergic agonist (LABA) that exerts its pharmacological effect by binding and activating beta2-adrenergic receptors located primarily in the lungs. |
CAS Number | [868049-49-4] |
Formula | C21H26N2O5 |
SMILES | COc1ccc(CC(C)(C)NC[C@H](O)c2cc(O)cc3NC(=O)COc23)cc1 |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
869477-96-3 | |
413.9 | |
C21H17ClFN3OS |
> 98% (HPLC) | |
868049-49-4 | |
386.4 | |
C21H26N2O5 |
99.58% | |
[869477-96-3] | |
422.9 | |
C21H27ClN2O5 |