You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303398 |
---|---|
Category | Small Molecules |
Description | Neoruscogenin |
CAS Number | 17676-33-4 |
Purity | 99.92% |
MW | 428.6 |
SMILES | [H][C@]12C[C@@]3([H])[C@]4([H])CC=C5C[C@@H](O)C[C@@H](O)[C@]5(C)[C@@]4([H])CC[C@]3(C)[C@@]1([H])[C@H](C)[C@@]1(CCC(=C)CO1)O2 |
Formula | C27H40O4 |
Biological Activity | 1. Neoruscogenin represents a universal pharmacological tool for RORα research due to its specific selectivity profile versus other nuclear receptors. |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |