You have no items in your shopping cart.
Cart summary
Methyl Oleate
Catalog Number: orb1304744
| Catalog Number | orb1304744 |
|---|---|
| Category | Small Molecules |
| Description | Methyl Oleate |
| Purity | 99.92% |
| MW | 296.49 |
| Biological Activity | Methyl oleate is a fatty acid methyl ester. It significantly improves antioxidant capacity, but also significantly weakens the anti-abrasive capacity of zinc dialkyl dithiophosphate. |
| CAS Number | [112-62-9] |
| Formula | C19H36O2 |
| SMILES | C(CC/C=C\CCCCCCCC)CCCCC(OC)=O |
| Storage | -20°C |
| Note | For research use only |
