You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1981362 |
---|---|
Category | Small Molecules |
Description | Mastoparan X, a tetradecapeptide derived from wasp venom, functions as a GTP-binding regulatory protein (G protein)-activating peptide. It directly activates G proteins coupled to phospholipase C, inducing secretion in various cell types [1]. |
Purity | 98.00% |
MW | 1555.97 |
Biological Activity | Mastoparan X, a tetradecapeptide derived from wasp venom, functions as a GTP-binding regulatory protein (G protein)-activating peptide. It directly activates G proteins coupled to phospholipase C, inducing secretion in various cell types [1]. |
CAS Number | [72093-22-2] |
Formula | C73H126N20O15S |
SMILES | C([C@H](NC([C@@H](NC([C@H]([C@H](CC)C)N)=O)CC(N)=O)=O)C(N[C@H](C(NCC(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC(C)C)C(N)=O)=O)CC(C)C)=O)CCCCN)=O)CCCCN)=O)C)=O)CCSC)=O)C)=O)C)=O)[C@H](CC)C)=O)=O)CCCCN)=O)C=1C=2C(NC1)=CC=CC2 |
Storage | -20°C |
Note | For research use only |
> 95% by hplc | |
1556 Da | |
H-Ile-Asn-Trp-Lys-Gly-Ile-Ala-Ala-Met-Ala-Lys-Lys-Leu-Leu-NH2 |