You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1983641 |
---|---|
Category | Small Molecules |
Description | Lysipressin Acetate is an analog of vasopressin, a powerful vasopressin used to regulate blood pressure. Endogenous vasopressin in most mammalian species. |
Purity | 98.00% |
MW | 1117.26 |
Biological Activity | Lysipressin Acetate is an analog of vasopressin, a powerful vasopressin used to regulate blood pressure. Endogenous vasopressin in most mammalian species. |
Formula | C48H68N12O15S2 |
SMILES | O=C([C@@H](N)CSSC[C@H](NC1=O)C(N2[C@H](C(N[C@H](C(NCC(O)=O)=O)CCCCN)=O)CCC2)=O)N[C@H](C(N[C@H](C(N[C@H](C(N[C@H]1CC(N)=O)=O)CCC(N)=O)=O)CC3=CC=CC=C3)=O)CC4=CC=C(O)C=C4.CC(O)=O |
Storage | -20°C |
Note | For research use only |
> 98% (HPLC) | |
83968-49-4 |
98.08% | |
83968-49-4 | |
1116.28 | |
C48H69N13O14S2 |