You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1303397 |
---|---|
Category | Small Molecules |
Description | Liriopesides B |
CAS Number | 87425-34-1 |
Purity | 99.95% |
MW | 722.9 |
SMILES | C[C@@]12[C@@]3([C@](C[C@]1([C@]4([C@](CC2)([C@@]5(C)[C@H](O[C@H]6[C@H](O)[C@@H](O)[C@@H](O)[C@@H](C)O6)C[C@H](O[C@H]7[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O7)CC5=CC4)[H])[H])[H])(O[C@@]8([C@H]3C)CC[C@H](C)CO8)[H])[H] |
Formula | C39H62O12 |
Biological Activity | Liriopesides B (Nolinospiroside F) exhibited potential anticancer activity against human ovarian cancer A2780 cells. |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
Filter by Rating