You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1302406 |
---|---|
Category | Small Molecules |
Description | LANOSTEROL |
Purity | 99.67% |
MW | 426.72 |
Biological Activity | Lanosterol (3β-Hydroxy-8,24-lanostadiene) is a tetracyclic triterpenoid which is the compound from which all steroids are derived. |
CAS Number | [79-63-0] |
Formula | C30H50O |
SMILES | [H][C@@]1(CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@]1([H])CC3)[C@H](C)CCC=C(C)C |
Storage | -20°C |
Note | For research use only |
IF, IH, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |