You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb321722 |
---|---|
Category | Small Molecules |
Description | L-Selectin |
CAS Number | 126880-86-2 |
Purity | ≥95% |
MW | 1427.74 |
SMILES | [H]N[C@@H](CS)C(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(O)=O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCSC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(O)=O |
Formula | C62H105N16O18S2 |
Storage | Storage Temp: -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
ELISA, IHC-P, WB | |
Human, Mouse, Porcine, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, ICC, IHC, IP, WB | |
Human, Mouse | |
Rabbit | |
Recombinant | |
Unconjugated |
Filter by Rating