You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb181260 |
---|---|
Category | Small Molecules |
Description | ISRIB (trans-isomer), the trans-isomer of ISRIB, is a potent and selective PERK inhibitor with IC50 of 5 nM. |
CAS Number | [1597403-47-8] |
MW | 451.344 |
SMILES | ClC1C([H])=C([H])C(=C([H])C=1[H])OC([H])([H])C(N([H])C1([H])C([H])([H])C([H])([H])C([H])(C([H])([H])C1([H])[H])N([H])C(C([H])([H])OC1C([H])=C([H])C(=C([H])C=1[H])Cl)=O)=O |
Formula | C22H24Cl2N2O4 |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
98.17% | |
1628478-15-8 | |
487.32 | |
C22H22Cl2F2N2O4 |
98.50% | |
1628478-12-5 | |
520.23 | |
C22H22Cl4N2O4 |
99.93% | |
548470-11-7 | |
451.34 | |
C22H24Cl2N2O4 |