You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb65316 |
---|---|
Category | Tools |
Description | IDP |
SMILES | OP(=O)(O)OP(=O)(OC[C@@H]1[C@H]([C@H]([C@@H](O1)n1c2c(nc1)c(=O)[nH]cn2)O)O)O |
Storage | store at -20 °C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
FC, ICC, IF, IHC, IHC-Fr, WB | |
Hamster | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
FC, ICC, IF, IHC, IHC-Fr, WB | |
Hamster | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC-P, WB | |
Animal, Bovine, Canine, Guinea pig, Human, Mouse, Rabbit, Rat, Sheep, Yeast | |
Canine, Equine, Guinea pig, Human, Mouse, Rat, Sheep, Yeast | |
Rabbit | |
Polyclonal | |
Unconjugated |
IHC-P, WB | |
Animal, Bovine, Canine, Guinea pig, Human, Mouse, Rabbit, Rat, Sheep | |
Canine, Equine, Guinea pig, Human, Mouse, Rat, Sheep | |
Rabbit | |
Polyclonal | |
Unconjugated |
Filter by Rating