You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1307409 |
---|---|
Category | Small Molecules |
Description | Hydroxy-PEG10-acid |
Purity | ≥98% |
MW | 530.6 |
Biological Activity | Hydroxy-PEG10-acid (HO-PEG10-CH2CH2COOH) is a PEG-based PROTAC linker that can be used to synthesize PROTACs[1]. |
CAS Number | 2375611-66-6 |
Formula | C23H46O13 |
SMILES | C(OCCOCCOCCOCCOCCOCCOCCO)COCCOCCOCCC(O)=O |
Storage | -20°C |
Note | For research use only |
98.00% | |
2388520-36-1 | |
873.48 | |
C41H69ClN6O12 |
98.00% | |
2388520-17-8 | |
837.025 | |
C41H68N6O12 |