You have no items in your shopping cart.
Cart summary
Hydroxy Ebastine
Catalog Number: orb1692828
| Catalog Number | orb1692828 |
|---|---|
| Category | Small Molecules |
| Description | Hydroxy Ebastine |
| CAS Number | 210686-41-2 |
| Purity | 98% |
| MW | 485.66 |
| SMILES | O=C(C1=CC=C(C=C1)C(C)(C)CO)CCCN2CCC(OC(C=3C=CC=CC3)C=4C=CC=CC4)CC2 |
| Formula | C32H39NO3 |
| Biological Activity | Hydroxy Ebastine is an ebastine metabolite. Ebastine undergoes rapid first-pass metabolism by the cytochrome P450 isoform CYP2J2 to form hydroxy ebastine which is then metabolized by CYP2J2 and CYP3A4 to form carebastine. |
| Storage | -20°C |
| Note | For research use only |
| Expiration Date | 12 months from date of receipt. |
