You have no items in your shopping cart.
Cart summary
HU-308
Catalog Number: orb2564332
| Catalog Number | orb2564332 |
|---|---|
| Category | Small Molecules |
| Description | HU-308, a synthetic cannabinoid analogue, is a highly selective agonist of the CB2 receptor. It demonstrates an affinity for the CB2 receptor that is over 440 times greater than its affinity for the CB1 receptor, which are predominantly found in immune cells. This compound plays a crucial role in modulating the immunosuppressive effects of the endocannabinoid system (ECS). Additionally, HU-308 possesses anti-inflammatory and neuroprotective properties, and it regulates the function of microglia. Its potential applications include research into neuroinflammation and retinal diseases. |
| Purity | 98.00% |
| MW | 414.62 |
| CAS Number | 1432056-41-1 |
| Formula | C27H42O3 |
| SMILES | O(C)C1=C([C@@H]2C3(C(C)(C)C(C3)(C(CO)=C2)[H])[H])C(OC)=CC(C(CCCCCC)(C)C)=C1 |
| Storage | -20°C |
| Note | For research use only |
