You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1942594 |
---|---|
Category | Small Molecules |
Description | Hs-1, an antimicrobial peptide, exhibits 80% protection against the Dengue-2 virus [1]. |
Purity | 98.00% |
MW | 2144.59 |
Biological Activity | Hs-1, an antimicrobial peptide, exhibits 80% protection against the Dengue-2 virus [1]. |
CAS Number | 1799386-27-8 |
Formula | C104H170N22O26 |
SMILES | C(N[C@H](C(N[C@H](C(N[C@H](C(=O)N1[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@@H](CC2=CC=CC=C2)C(N[C@H](C(N[C@H](C(N[C@H](C(NCC(O)=O)=O)CCC(N)=O)=O)CCCCN)=O)CC(C)C)=O)=O)CO)=O)CO)=O)CC(C)C)=O)C)=O)[C@@H](C)O)=O)[C@H](C)C)=O)[C@H](CC)C)=O)CO)=O)CCC1)CC(C)C)=O)[C@H](CC)C)=O)CC(C)C)(=O)[C@H]3N(C([C@@H](NC([C@H](CC4=CC=CC=C4)N)=O)CC(C)C)=O)CCC3 |
Storage | -20°C |
Note | For research use only |
ELISA, IF, IHC, WB | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Gallus, Porcine | |
Human, Mouse, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |