You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2663465 |
---|---|
Category | Small Molecules |
Description | Hesperetin dihydrochalcone-4′-O-β-D-glucoside, a dihydrochalcone compound, exhibits flavor-modulating properties in various natural zero-calorie/low-calorie sweeteners. |
Purity | 98.00% |
MW | 466.44 |
CAS Number | 21940-36-3 |
Formula | C22H26O11 |
SMILES | O(C1=CC(O)=C(C(CCC2=CC(O)=C(OC)C=C2)=O)C(O)=C1)[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O |
Storage | -20°C |
Note | For research use only |