You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2564128 |
---|---|
Category | Small Molecules |
Description | Gypsogenin 3-O-glucuronide, a glucuronide isolated from Gypsophila, exhibits cytotoxic effects on THP-1 cells [1]. |
Purity | 98.00% |
MW | 646.81 |
CAS Number | 105762-16-1 |
Formula | C36H54O10 |
SMILES | C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@@](C=O)(C)[C@@H](O[C@@H]4O[C@H](C(O)=O)[C@@H](O)[C@H](O)[C@H]4O)CC3)[H])(CC=C5[C@@]2(C)CC[C@]6(C(O)=O)[C@]5(CC(C)(C)CC6)[H])[H] |
Storage | -20°C |
Note | For research use only |
99.33% | |
[96553-02-5] | |
660.83 | |
C37H56O10 |