You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1301181 |
---|---|
Category | Small Molecules |
Description | WAY-622024 |
Purity | 99.94% |
MW | 222.2 |
Biological Activity | GPCR agonist-2 (4-(Cyclopropylamino)-3-nitrobenzoic acid) is an agonist of the orphan human GPCR GPR109B. |
CAS Number | [291528-35-3] |
Formula | C10H10N2O4 |
SMILES | N(=O)(=O)C1=C(NC2CC2)C=CC(C(O)=O)=C1 |
Storage | -20°C |
Note | For research use only |
98.40% | |
494191-73-0 | |
342.34 | |
C17H11FN2O3S |
99.04% | |
150085-21-5 | |
309.45 | |
C21H27NO |