You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2564986 |
---|---|
Category | Small Molecules |
Description | Glucocorticoid Receptor Agonist-3 (Preparation 6) acts as a glucocorticoid receptor agonist [1]. |
Purity | 98.00% |
MW | 617.70 |
CAS Number | 2842165-73-3 |
Formula | C36H40FNO7 |
SMILES | C(CO)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(O[C@@H](O2)C4=C(F)C(OCC5=CC(N)=CC=C5)=CC=C4C)[H])([C@]6([C@]([C@@H](O)C3)([C@]7(C)C(CC6)=CC(=O)C=C7)[H])[H])[H] |
Storage | -20°C |
Note | For research use only |
98.00% | |
3014393-35-9 | |
910.98 | |
C49H55FN4O12 |