You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb2564975 |
---|---|
Category | Small Molecules |
Description | Glucocorticoid Receptor Agonist-4 (Compound Preparation 5) serves as an agonist for glucocorticoid receptors and can be conjugated with TNF-α antibodies, facilitating research into autoimmune and inflammatory diseases [1]. |
Purity | 98.00% |
MW | 617.7 |
CAS Number | 2842165-72-2 |
Formula | C36H40FNO7 |
SMILES | C(CO)(=O)[C@]12[C@]3(C)[C@@](C[C@]1(O[C@H](O2)C4=C(F)C(OCC5=CC(N)=CC=C5)=CC=C4C)[H])([C@]6([C@]([C@@H](O)C3)([C@]7(C)C(CC6)=CC(=O)C=C7)[H])[H])[H] |
Storage | -20°C |
Note | For research use only |
98.00% | |
3014393-37-1 | |
910.98 | |
C49H55FN4O12 |