You have no items in your shopping cart.
You have no items in your shopping cart.
Catalog Number | orb1299949 |
---|---|
Category | Small Molecules |
Description | FITM |
CAS Number | 932737-65-0 |
Purity | 98% |
MW | 371.43 |
SMILES | CC(C)Nc1cc(ncn1)-c1csc(n1)N(C)C(=O)c1ccc(F)cc1 |
Formula | C18H18FN5OS |
Biological Activity | FITM is a potent negative allosteric modulator of mGlu1 receptor(Ki : 2.5 nM). |
Storage | -20°C |
Note | For research use only |
Expiration Date | 12 months from date of receipt. |
IF, IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Mouse, Rabbit, Sheep | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Unconjugated |
IF | |
Bovine, Canine, Equine, Mouse, Rabbit, Sheep | |
Human, Rat | |
Rabbit | |
Polyclonal | |
Cy5 |
IF | |
Bovine, Canine, Equine, Mouse, Rabbit, Sheep | |
Human, Rat | |
Rabbit | |
Polyclonal | |
PE/Cy5.5 |
IF | |
Bovine, Canine, Equine, Mouse, Rabbit, Sheep | |
Human, Rat | |
Rabbit | |
Polyclonal | |
PE/Cy7 |
IHC-Fr, IHC-P, WB | |
Bovine, Canine, Equine, Mouse, Rabbit, Sheep | |
Human, Rat | |
Rabbit | |
Polyclonal | |
AP |